C19H17N3O2 — CID 135659956
2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3H-quinazolin-4-one (PubChem CID 135659956) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3H-quinazolin-4-one.
| Compound Name | 2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135659956 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[3-(2,3-dihydroindol-1-yl)-3-oxopropyl]-3H-quinazolin-4-one |
| SMILES | O=C(CCc1nc2ccccc2c(=O)[nH]1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H17N3O2/c23-18(22-12-11-13-5-1-4-8-16(13)22)10-9-17-20-15-7-3-2-6-14(15)19(24)21-17/h1-8H,9-12H2,(H,20,21,24) |
| InChIKey | PMRJWJYDRXHBRT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |