C22H21Cl2N5OS — CID 135660034
7-(2,6-dichlorophenyl)-2-ethylsulfanyl-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660034) has the molecular formula C22H21Cl2N5OS and a molecular weight of 474.42 g/mol. Its IUPAC name is 7-(2,6-dichlorophenyl)-2-ethylsulfanyl-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(2,6-dichlorophenyl)-2-ethylsulfanyl-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660034 |
| Molecular Formula | C22H21Cl2N5OS |
| Molecular Weight | 474.42 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 7-(2,6-dichlorophenyl)-2-ethylsulfanyl-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCSc1nc2n(n1)C(c1c(Cl)cccc1Cl)C(C(=O)Nc1cccc(C)c1)=C(C)N2 |
| InChI | InChI=1S/C22H21Cl2N5OS/c1-4-31-22-27-21-25-13(3)17(20(30)26-14-8-5-7-12(2)11-14)19(29(21)28-22)18-15(23)9-6-10-16(18)24/h5-11,19H,4H2,1-3H3,(H,26,30)(H,25,27,28) |
| InChIKey | WQBZXESGYPXVHF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.42 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |