C33H36ClN5O3S — CID 135663434
2-[(2-chlorophenyl)methylsulfanyl]-7-(3-methoxy-4-pentoxyphenyl)-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135663434) has the molecular formula C33H36ClN5O3S and a molecular weight of 618.20 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-methoxy-4-pentoxyphenyl)-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-methoxy-4-pentoxyphenyl)-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135663434 |
| Molecular Formula | C33H36ClN5O3S |
| Molecular Weight | 618.20 g/mol |
| Exact Mass | 617.22 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(3-methoxy-4-pentoxyphenyl)-5-methyl-N-(3-methylphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCCOc1ccc(C2C(C(=O)Nc3cccc(C)c3)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1OC |
| InChI | InChI=1S/C33H36ClN5O3S/c1-5-6-9-17-42-27-16-15-23(19-28(27)41-4)30-29(31(40)36-25-13-10-11-21(2)18-25)22(3)35-32-37-33(38-39(30)32)43-20-24-12-7-8-14-26(24)34/h7-8,10-16,18-19,30H,5-6,9,17,20H2,1-4H3,(H,36,40)(H,35,37,38) |
| InChIKey | VPKUBEKLMVDZOO-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.20 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|