C31H31ClN4O4S — CID 135663580
benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135663580) has the molecular formula C31H31ClN4O4S and a molecular weight of 591.13 g/mol. Its IUPAC name is benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135663580 |
| Molecular Formula | C31H31ClN4O4S |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | benzyl 2-[(2-chlorophenyl)methylsulfanyl]-7-(3,4-diethoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOc1ccc(C2C(C(=O)OCc3ccccc3)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1OCC |
| InChI | InChI=1S/C31H31ClN4O4S/c1-4-38-25-16-15-22(17-26(25)39-5-2)28-27(29(37)40-18-21-11-7-6-8-12-21)20(3)33-30-34-31(35-36(28)30)41-19-23-13-9-10-14-24(23)32/h6-17,28H,4-5,18-19H2,1-3H3,(H,33,34,35) |
| InChIKey | ANWTXDFELLFADE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |