C26H28BrClN4O4S — CID 135664193
ethyl 7-(3-bromo-4,5-diethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135664193) has the molecular formula C26H28BrClN4O4S and a molecular weight of 607.96 g/mol. Its IUPAC name is ethyl 7-(3-bromo-4,5-diethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | ethyl 7-(3-bromo-4,5-diethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135664193 |
| Molecular Formula | C26H28BrClN4O4S |
| Molecular Weight | 607.96 g/mol |
| Exact Mass | 606.07 |
| IUPAC Name | ethyl 7-(3-bromo-4,5-diethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc(SCc3ccccc3Cl)nn2C1c1cc(Br)c(OCC)c(OCC)c1 |
| InChI | InChI=1S/C26H28BrClN4O4S/c1-5-34-20-13-17(12-18(27)23(20)35-6-2)22-21(24(33)36-7-3)15(4)29-25-30-26(31-32(22)25)37-14-16-10-8-9-11-19(16)28/h8-13,22H,5-7,14H2,1-4H3,(H,29,30,31) |
| InChIKey | ZFLBBSATSKUGER-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.96 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |