C34H37BrClN5O3S — CID 135664488
7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135664488) has the molecular formula C34H37BrClN5O3S and a molecular weight of 711.13 g/mol. Its IUPAC name is 7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135664488 |
| Molecular Formula | C34H37BrClN5O3S |
| Molecular Weight | 711.13 g/mol |
| Exact Mass | 709.15 |
| IUPAC Name | 7-(3-bromo-4-butoxy-5-ethoxyphenyl)-2-[(2-chlorophenyl)methylsulfanyl]-N-(2,4-dimethylphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCCCOc1c(Br)cc(C2C(C(=O)Nc3ccc(C)cc3C)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1OCC |
| InChI | InChI=1S/C34H37BrClN5O3S/c1-6-8-15-44-31-25(35)17-24(18-28(31)43-7-2)30-29(32(42)38-27-14-13-20(3)16-21(27)4)22(5)37-33-39-34(40-41(30)33)45-19-23-11-9-10-12-26(23)36/h9-14,16-18,30H,6-8,15,19H2,1-5H3,(H,38,42)(H,37,39,40) |
| InChIKey | IJJLXVGMTCIATA-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.13 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|