About (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine
(NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine (PubChem CID 135665063) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine |
| PubChem CID | 135665063 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine |
| SMILES | CCCc1n[nH]c2c1/C(=N/O)CC(C)(C)C2 |
| InChI | InChI=1S/C12H19N3O/c1-4-5-8-11-9(14-13-8)6-12(2,3)7-10(11)15-16/h16H,4-7H2,1-3H3,(H,13,14)/b15-10+ |
| InChIKey | LMBUFSHRHWDKOE-XNTDXEJSSA-N |
| XLogP | 2.51 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine?
The IUPAC name of (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine (CID 135665063) is (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine is CCCc1n[nH]c2c1/C(=N/O)CC(C)(C)C2.
What is the InChIKey of (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine?
The InChIKey is LMBUFSHRHWDKOE-XNTDXEJSSA-N. The full InChI is InChI=1S/C12H19N3O/c1-4-5-8-11-9(14-13-8)6-12(2,3)7-10(11)15-16/h16H,4-7H2,1-3H3,(H,13,14)/b15-10+.
What are the key properties of (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine?
(NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine has a molecular weight of 221.30 g/mol, XLogP of 2.51, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(6,6-dimethyl-3-propyl-5,7-dihydro-1H-indazol-4-ylidene)hydroxylamine is sourced from PubChem (CID 135665063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).