C23H29N5O3 — CID 135665146
2-(4-butoxy-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)-N,N-diethylethanamine (PubChem CID 135665146) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 2-(4-butoxy-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)-N,N-diethylethanamine.
| Compound Name | 2-(4-butoxy-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 135665146 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-(4-butoxy-10-nitro-8,14,15-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2(7),3,5,9,11,13(16)-heptaen-14-yl)-N,N-diethylethanamine |
| SMILES | CCCCOc1ccc2c(c1)-c1nn(CCN(CC)CC)c3ccc([N+](=O)[O-])c(c13)N2 |
| InChI | InChI=1S/C23H29N5O3/c1-4-7-14-31-16-8-9-18-17(15-16)22-21-19(10-11-20(28(29)30)23(21)24-18)27(25-22)13-12-26(5-2)6-3/h8-11,15,24H,4-7,12-14H2,1-3H3 |
| InChIKey | RALOZQCIVUXVIJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|