C20H23N3O3S — CID 135665197
N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-4-thiophen-2-ylbutanamide (PubChem CID 135665197) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 135665197 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(2-methoxyethyl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]-4-thiophen-2-ylbutanamide |
| SMILES | COCCN(Cc1nc2ccccc2c(=O)[nH]1)C(=O)CCCc1cccs1 |
| InChI | InChI=1S/C20H23N3O3S/c1-26-12-11-23(19(24)10-4-6-15-7-5-13-27-15)14-18-21-17-9-3-2-8-16(17)20(25)22-18/h2-3,5,7-9,13H,4,6,10-12,14H2,1H3,(H,21,22,25) |
| InChIKey | VWOKAMDPSQHODH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |