C19H16N3O5S- — CID 135665228
4-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate (PubChem CID 135665228) has the molecular formula C19H16N3O5S- and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 135665228 |
| Molecular Formula | C19H16N3O5S- |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-[(E)-[2-(4-ethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxy-6-nitrophenolate |
| SMILES | CCc1ccc(/N=C2/NC(=O)/C(=C\c3cc(OC)c([O-])c([N+](=O)[O-])c3)S2)cc1 |
| InChI | InChI=1S/C19H17N3O5S/c1-3-11-4-6-13(7-5-11)20-19-21-18(24)16(28-19)10-12-8-14(22(25)26)17(23)15(9-12)27-2/h4-10,23H,3H2,1-2H3,(H,20,21,24)/p-1/b16-10+ |
| InChIKey | XYHIMOKLNQQMLK-MHWRWJLKSA-M |
| XLogP | 3.13 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|