C19H14N3O4S- — CID 135665626
4-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 135665626) has the molecular formula C19H14N3O4S- and a molecular weight of 380.41 g/mol. Its IUPAC name is 4-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | 4-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 135665626 |
| Molecular Formula | C19H14N3O4S- |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 4-[[2-[(6-oxo-4-phenyl-1H-pyrimidin-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | O=C(CSc1nc(-c2ccccc2)cc(=O)[nH]1)Nc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H15N3O4S/c23-16-10-15(12-4-2-1-3-5-12)21-19(22-16)27-11-17(24)20-14-8-6-13(7-9-14)18(25)26/h1-10H,11H2,(H,20,24)(H,25,26)(H,21,22,23)/p-1 |
| InChIKey | GZEDYOMCLIIYMQ-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |