C39H15F15N4O2 — CID 135665879
(Z)-methoxy-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13,22,24-tetrahydrocorrin-3-ylidene]methanol (PubChem CID 135665879) has the molecular formula C39H15F15N4O2 and a molecular weight of 856.54 g/mol. Its IUPAC name is (Z)-methoxy-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13,22,24-tetrahydrocorrin-3-ylidene]methanol.
| Compound Name | (Z)-methoxy-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13,22,24-tetrahydrocorrin-3-ylidene]methanol |
|---|---|
| PubChem CID | 135665879 |
| Molecular Formula | C39H15F15N4O2 |
| Molecular Weight | 856.54 g/mol |
| Exact Mass | 856.10 |
| IUPAC Name | (Z)-methoxy-[5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-12,13,22,24-tetrahydrocorrin-3-ylidene]methanol |
| SMILES | CO/C(O)=C1/C=C2N=C1/C(c1c(F)c(F)c(F)c(F)c1F)=c1/cc/c([nH]1)=C(\c1c(F)c(F)c(F)c(F)c1F)C1=N/C(=C(/c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)CC1 |
| InChI | InChI=1S/C39H15F15N4O2/c1-60-39(59)9-8-16-10-2-3-11(55-10)17(20-23(40)29(46)35(52)30(47)24(20)41)12-4-5-13(56-12)18(21-25(42)31(48)36(53)32(49)26(21)43)14-6-7-15(57-14)19(38(9)58-16)22-27(44)33(50)37(54)34(51)28(22)45/h2-3,6-8,55,57,59H,4-5H2,1H3/b17-12+,18-14+,19-15-,39-9- |
| InChIKey | WSIRYJRCMXGNLY-XUTPVHHPSA-N |
| XLogP | 8.75 |
| TPSA | 85.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.54 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|