C9H9F3N2O — CID 135665929
2-methyl-5-prop-2-enyl-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 135665929) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is 2-methyl-5-prop-2-enyl-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-prop-2-enyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135665929 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-methyl-5-prop-2-enyl-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | C=CCc1c(C(F)(F)F)nc(C)[nH]c1=O |
| InChI | InChI=1S/C9H9F3N2O/c1-3-4-6-7(9(10,11)12)13-5(2)14-8(6)15/h3H,1,4H2,2H3,(H,13,14,15) |
| InChIKey | XSHJYKPPLVFIJJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|