C33H29Cl3N6O4 — CID 135665971
2-(2,4-dimethylphenoxy)-N-[3-[[4-[(4-ethoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]acetamide (PubChem CID 135665971) has the molecular formula C33H29Cl3N6O4 and a molecular weight of 679.99 g/mol. Its IUPAC name is 2-(2,4-dimethylphenoxy)-N-[3-[[4-[(4-ethoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]acetamide.
| Compound Name | 2-(2,4-dimethylphenoxy)-N-[3-[[4-[(4-ethoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 135665971 |
| Molecular Formula | C33H29Cl3N6O4 |
| Molecular Weight | 679.99 g/mol |
| Exact Mass | 678.13 |
| IUPAC Name | 2-(2,4-dimethylphenoxy)-N-[3-[[4-[(4-ethoxyphenyl)diazenyl]-5-oxo-1-(2,4,6-trichlorophenyl)pyrazolidin-3-ylidene]amino]phenyl]acetamide |
| SMILES | CCOc1ccc(/N=N/C2C(=O)N(c3c(Cl)cc(Cl)cc3Cl)N/C2=N\c2cccc(NC(=O)COc3ccc(C)cc3C)c2)cc1 |
| InChI | InChI=1S/C33H29Cl3N6O4/c1-4-45-25-11-9-22(10-12-25)39-40-30-32(41-42(33(30)44)31-26(35)15-21(34)16-27(31)36)38-24-7-5-6-23(17-24)37-29(43)18-46-28-13-8-19(2)14-20(28)3/h5-17,30H,4,18H2,1-3H3,(H,37,43)(H,38,41)/b40-39+ |
| InChIKey | MYZBFCKAVHQTLD-XQQUEIPISA-N |
| XLogP | 8.41 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.99 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|