C14H8N9O2+ — CID 135666314
[(E)-[amino-[(2,3-dicyano-1H-indeno[2,3-b]pyrazin-9-yl)diazenyl]methylidene]amino]-hydroxy-oxoazanium (PubChem CID 135666314) has the molecular formula C14H8N9O2+ and a molecular weight of 334.28 g/mol. Its IUPAC name is [(E)-[amino-[(2,3-dicyano-1H-indeno[2,3-b]pyrazin-9-yl)diazenyl]methylidene]amino]-hydroxy-oxoazanium.
| Compound Name | [(E)-[amino-[(2,3-dicyano-1H-indeno[2,3-b]pyrazin-9-yl)diazenyl]methylidene]amino]-hydroxy-oxoazanium |
|---|---|
| PubChem CID | 135666314 |
| Molecular Formula | C14H8N9O2+ |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [(E)-[amino-[(2,3-dicyano-1H-indeno[2,3-b]pyrazin-9-yl)diazenyl]methylidene]amino]-hydroxy-oxoazanium |
| SMILES | N#Cc1nc2c3ccccc3c(/N=N/C(N)=N/[N+](=O)O)c-2[nH]c1C#N |
| InChI | InChI=1S/C14H8N9O2/c15-5-9-10(6-16)19-13-11(18-9)7-3-1-2-4-8(7)12(13)20-21-14(17)22-23(24)25/h1-4,19H,(H2,17,22)(H,24,25)/q+1/b21-20+ |
| InChIKey | URAPNGIIGCYWPC-QZQOTICOSA-N |
| XLogP | 1.89 |
| TPSA | 179.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|