About sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate
sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate (PubChem CID 135666390) has the molecular formula C12H9N2NaO6S
and a molecular weight of 332.27 g/mol. Its IUPAC name is sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate.
Molecular Properties
| Compound Name | sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate |
| PubChem CID | 135666390 |
| Molecular Formula | C12H9N2NaO6S |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccc(O)c(/N=N/c2ccc(O)cc2O)c1.[Na+] |
| InChI | InChI=1S/C12H10N2O6S.Na/c15-7-1-3-9(12(17)5-7)13-14-10-6-8(21(18,19)20)2-4-11(10)16;/h1-6,15-17H,(H,18,19,20);/q;+1/p-1/b14-13+; |
| InChIKey | MOLJFAGWUXDJJC-IERUDJENSA-M |
| XLogP | -0.87 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate?
The IUPAC name of sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate (CID 135666390) is sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate.
What is the SMILES notation for sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate?
The canonical SMILES for sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate is O=S(=O)([O-])c1ccc(O)c(/N=N/c2ccc(O)cc2O)c1.[Na+].
What is the InChIKey of sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate?
The InChIKey is MOLJFAGWUXDJJC-IERUDJENSA-M. The full InChI is InChI=1S/C12H10N2O6S.Na/c15-7-1-3-9(12(17)5-7)13-14-10-6-8(21(18,19)20)2-4-11(10)16;/h1-6,15-17H,(H,18,19,20);/q;+1/p-1/b14-13+;.
What are the key properties of sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate?
sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate has a molecular weight of 332.27 g/mol, XLogP of -0.87, 3 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-[(2,4-dihydroxyphenyl)diazenyl]-4-hydroxybenzenesulfonate is sourced from PubChem (CID 135666390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).