C22H31NO3S — CID 135666733
5-(4-butylsulfanylphenyl)-2-[(E)-N-ethoxy-C-propylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one (PubChem CID 135666733) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is 5-(4-butylsulfanylphenyl)-2-[(E)-N-ethoxy-C-propylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 5-(4-butylsulfanylphenyl)-2-[(E)-N-ethoxy-C-propylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135666733 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 5-(4-butylsulfanylphenyl)-2-[(E)-N-ethoxy-C-propylcarbonimidoyl]-3-hydroxycyclohex-2-en-1-one |
| SMILES | CCCCSc1ccc(C2CC(=O)C(/C(CCC)=N/OCC)=C(O)C2)cc1 |
| InChI | InChI=1S/C22H31NO3S/c1-4-7-13-27-18-11-9-16(10-12-18)17-14-20(24)22(21(25)15-17)19(8-5-2)23-26-6-3/h9-12,17,24H,4-8,13-15H2,1-3H3/b23-19+ |
| InChIKey | ZSOZMDAIVLKMTJ-FCDQGJHFSA-N |
| XLogP | 6.03 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|