About phenanthridine-1-thiol
phenanthridine-1-thiol (PubChem CID 135666738) has the molecular formula C13H9NS
and a molecular weight of 211.29 g/mol. Its IUPAC name is phenanthridine-1-thiol.
Molecular Properties
| Compound Name | phenanthridine-1-thiol |
| PubChem CID | 135666738 |
| Molecular Formula | C13H9NS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | phenanthridine-1-thiol |
| SMILES | Sc1cccc2ncc3ccccc3c12 |
| InChI | InChI=1S/C13H9NS/c15-12-7-3-6-11-13(12)10-5-2-1-4-9(10)8-14-11/h1-8,15H |
| InChIKey | IKCWJYAKTYWDGF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze phenanthridine-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthridine-1-thiol?
The IUPAC name of phenanthridine-1-thiol (CID 135666738) is phenanthridine-1-thiol.
What is the SMILES notation for phenanthridine-1-thiol?
The canonical SMILES for phenanthridine-1-thiol is Sc1cccc2ncc3ccccc3c12.
What is the InChIKey of phenanthridine-1-thiol?
The InChIKey is IKCWJYAKTYWDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NS/c15-12-7-3-6-11-13(12)10-5-2-1-4-9(10)8-14-11/h1-8,15H.
What are the key properties of phenanthridine-1-thiol?
phenanthridine-1-thiol has a molecular weight of 211.29 g/mol, XLogP of 3.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthridine-1-thiol is sourced from PubChem (CID 135666738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).