About 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one
1,6-dihydropyrrolo[2,3-d]pyridazin-7-one (PubChem CID 135667596) has the molecular formula C6H5N3O
and a molecular weight of 135.13 g/mol. Its IUPAC name is 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one.
Molecular Properties
| Compound Name | 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one |
| PubChem CID | 135667596 |
| Molecular Formula | C6H5N3O |
| Molecular Weight | 135.13 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one |
| SMILES | O=c1[nH]ncc2cc[nH]c12 |
| InChI | InChI=1S/C6H5N3O/c10-6-5-4(1-2-7-5)3-8-9-6/h1-3,7H,(H,9,10) |
| InChIKey | GCZDEDRWKMORDZ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.13 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one?
The IUPAC name of 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one (CID 135667596) is 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one.
What is the SMILES notation for 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one?
The canonical SMILES for 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one is O=c1[nH]ncc2cc[nH]c12.
What is the InChIKey of 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one?
The InChIKey is GCZDEDRWKMORDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3O/c10-6-5-4(1-2-7-5)3-8-9-6/h1-3,7H,(H,9,10).
What are the key properties of 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one?
1,6-dihydropyrrolo[2,3-d]pyridazin-7-one has a molecular weight of 135.13 g/mol, XLogP of 0.25, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrrolo[2,3-d]pyridazin-7-one is sourced from PubChem (CID 135667596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).