C21H21N3O4 — CID 135667806
2-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]ethyl acetate (PubChem CID 135667806) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]ethyl acetate.
| Compound Name | 2-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]ethyl acetate |
|---|---|
| PubChem CID | 135667806 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 2-[(3-benzyl-2-oxo-3,5-dihydro-1H-imidazo[2,1-b]quinazolin-7-yl)oxy]ethyl acetate |
| SMILES | CC(=O)OCCOc1ccc2c(c1)CN1C(=N2)NC(=O)C1Cc1ccccc1 |
| InChI | InChI=1S/C21H21N3O4/c1-14(25)27-9-10-28-17-7-8-18-16(12-17)13-24-19(20(26)23-21(24)22-18)11-15-5-3-2-4-6-15/h2-8,12,19H,9-11,13H2,1H3,(H,22,23,26) |
| InChIKey | IHMJDGNPFZDRKU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|