C19H13FN2O5 — CID 1356679
5-(1,3-benzodioxol-5-ylmethylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 1356679) has the molecular formula C19H13FN2O5 and a molecular weight of 368.32 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1356679 |
| Molecular Formula | C19H13FN2O5 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1-[(4-fluorophenyl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(Cc2ccc(F)cc2)C(=O)C1=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H13FN2O5/c20-13-4-1-11(2-5-13)9-22-18(24)14(17(23)21-19(22)25)7-12-3-6-15-16(8-12)27-10-26-15/h1-8H,9-10H2,(H,21,23,25) |
| InChIKey | BGHDCRMPPHKQKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|