C15H12FN3O2 — CID 135668640
5-[(2-fluorophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 135668640) has the molecular formula C15H12FN3O2 and a molecular weight of 285.28 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2-fluorophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668640 |
| Molecular Formula | C15H12FN3O2 |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-[(2-fluorophenyl)iminomethyl]-6-hydroxy-1,4-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2ccccc2F)c(O)n(C)c(=O)c1C#N |
| InChI | InChI=1S/C15H12FN3O2/c1-9-10(7-17)14(20)19(2)15(21)11(9)8-18-13-6-4-3-5-12(13)16/h3-6,8,21H,1-2H3/b18-8+ |
| InChIKey | BUXQRDGMSWNXRD-QGMBQPNBSA-N |
| XLogP | 2.16 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|