C27H28ClN3O3 — CID 135670630
2-[[(3-benzhydryloxy-2-hydroxypropyl)-ethylamino]methyl]-7-chloro-3H-quinazolin-4-one (PubChem CID 135670630) has the molecular formula C27H28ClN3O3 and a molecular weight of 477.99 g/mol. Its IUPAC name is 2-[[(3-benzhydryloxy-2-hydroxypropyl)-ethylamino]methyl]-7-chloro-3H-quinazolin-4-one.
| Compound Name | 2-[[(3-benzhydryloxy-2-hydroxypropyl)-ethylamino]methyl]-7-chloro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135670630 |
| Molecular Formula | C27H28ClN3O3 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-[[(3-benzhydryloxy-2-hydroxypropyl)-ethylamino]methyl]-7-chloro-3H-quinazolin-4-one |
| SMILES | CCN(Cc1nc2cc(Cl)ccc2c(=O)[nH]1)CC(O)COC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28ClN3O3/c1-2-31(17-25-29-24-15-21(28)13-14-23(24)27(33)30-25)16-22(32)18-34-26(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-15,22,26,32H,2,16-18H2,1H3,(H,29,30,33) |
| InChIKey | AWJJLTUWXUNQHD-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |