C20H23N3O2S — CID 135670638
2-[[2-(4-methoxyphenyl)azepan-1-yl]methyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135670638) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 2-[[2-(4-methoxyphenyl)azepan-1-yl]methyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[2-(4-methoxyphenyl)azepan-1-yl]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135670638 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-[[2-(4-methoxyphenyl)azepan-1-yl]methyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(C2CCCCCN2Cc2nc3ccsc3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-25-15-8-6-14(7-9-15)17-5-3-2-4-11-23(17)13-18-21-16-10-12-26-19(16)20(24)22-18/h6-10,12,17H,2-5,11,13H2,1H3,(H,21,22,24) |
| InChIKey | MZHVEWCBWWNJKQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |