C24H25NO3S — CID 135671112
(Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol (PubChem CID 135671112) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol.
| Compound Name | (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol |
|---|---|
| PubChem CID | 135671112 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | (Z,1S,2R,3R)-2-ethenyl-7-(2-hydroxyphenyl)-6-pyridin-2-yl-1-thiophen-2-ylhept-6-ene-1,3-diol |
| SMILES | C=C[C@H]([C@H](O)CC/C(=C/c1ccccc1O)c1ccccn1)[C@H](O)c1cccs1 |
| InChI | InChI=1S/C24H25NO3S/c1-2-19(24(28)23-11-7-15-29-23)22(27)13-12-17(20-9-5-6-14-25-20)16-18-8-3-4-10-21(18)26/h2-11,14-16,19,22,24,26-28H,1,12-13H2/b17-16-/t19-,22-,24+/m1/s1 |
| InChIKey | PIZZEZYFEYMHHL-OUHLVZGRSA-N |
| XLogP | 5.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|