C30H33N4O4+ — CID 135671164
[4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-ethyl-formyl-(2-hydroxyethyl)azanium (PubChem CID 135671164) has the molecular formula C30H33N4O4+ and a molecular weight of 513.62 g/mol. Its IUPAC name is [4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-ethyl-formyl-(2-hydroxyethyl)azanium.
| Compound Name | [4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-ethyl-formyl-(2-hydroxyethyl)azanium |
|---|---|
| PubChem CID | 135671164 |
| Molecular Formula | C30H33N4O4+ |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | [4-[4,6-bis(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenoxy]-ethyl-formyl-(2-hydroxyethyl)azanium |
| SMILES | CC[N+](C=O)(CCO)Oc1ccc(-c2nc(-c3ccc(C)cc3C)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/C30H32N4O4/c1-6-34(18-36,13-14-35)38-23-9-12-26(27(37)17-23)30-32-28(24-10-7-19(2)15-21(24)4)31-29(33-30)25-11-8-20(3)16-22(25)5/h7-12,15-18,35H,6,13-14H2,1-5H3/p+1 |
| InChIKey | BFFHXGLOHQKFAA-UHFFFAOYSA-O |
| XLogP | 5.09 |
| TPSA | 105.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|