C22H20N4O4 — CID 135671169
6-hydroxy-5-[(E,3Z)-3-[1-(2-hydroxyethyl)-3-methyl-5-oxopyrazol-4-ylidene]prop-1-enyl]-4-methyl-2-oxo-1-phenylpyridine-3-carbonitrile (PubChem CID 135671169) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 6-hydroxy-5-[(E,3Z)-3-[1-(2-hydroxyethyl)-3-methyl-5-oxopyrazol-4-ylidene]prop-1-enyl]-4-methyl-2-oxo-1-phenylpyridine-3-carbonitrile.
| Compound Name | 6-hydroxy-5-[(E,3Z)-3-[1-(2-hydroxyethyl)-3-methyl-5-oxopyrazol-4-ylidene]prop-1-enyl]-4-methyl-2-oxo-1-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135671169 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 6-hydroxy-5-[(E,3Z)-3-[1-(2-hydroxyethyl)-3-methyl-5-oxopyrazol-4-ylidene]prop-1-enyl]-4-methyl-2-oxo-1-phenylpyridine-3-carbonitrile |
| SMILES | CC1=NN(CCO)C(=O)/C1=C\C=C\c1c(C)c(C#N)c(=O)n(-c2ccccc2)c1O |
| InChI | InChI=1S/C22H20N4O4/c1-14-17(9-6-10-18-15(2)24-25(11-12-27)20(18)28)21(29)26(22(30)19(14)13-23)16-7-4-3-5-8-16/h3-10,27,29H,11-12H2,1-2H3/b9-6+,18-10- |
| InChIKey | KXSCWYNKENPVAQ-CVCOPPNTSA-N |
| XLogP | 1.87 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|