C19H23N3O — CID 135672670
2-(4-tert-butylphenyl)-N-[(E)-1H-pyrrol-2-ylmethylideneamino]cyclopropane-1-carboxamide (PubChem CID 135672670) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-N-[(E)-1H-pyrrol-2-ylmethylideneamino]cyclopropane-1-carboxamide.
| Compound Name | 2-(4-tert-butylphenyl)-N-[(E)-1H-pyrrol-2-ylmethylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135672670 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-N-[(E)-1H-pyrrol-2-ylmethylideneamino]cyclopropane-1-carboxamide |
| SMILES | CC(C)(C)c1ccc(C2CC2C(=O)N/N=C/c2ccc[nH]2)cc1 |
| InChI | InChI=1S/C19H23N3O/c1-19(2,3)14-8-6-13(7-9-14)16-11-17(16)18(23)22-21-12-15-5-4-10-20-15/h4-10,12,16-17,20H,11H2,1-3H3,(H,22,23)/b21-12+ |
| InChIKey | SADCRQJOKMCNEX-CIAFOILYSA-N |
| XLogP | 3.57 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|