C15H10F2N4O2S — CID 135672951
5-(2,5-difluorophenyl)-N-(2-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135672951) has the molecular formula C15H10F2N4O2S and a molecular weight of 348.33 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-N-(2-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(2,5-difluorophenyl)-N-(2-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135672951 |
| Molecular Formula | C15H10F2N4O2S |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 5-(2,5-difluorophenyl)-N-(2-nitrophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | O=[N+]([O-])c1ccccc1/N=C1/NN=C(c2cc(F)ccc2F)CS1 |
| InChI | InChI=1S/C15H10F2N4O2S/c16-9-5-6-11(17)10(7-9)13-8-24-15(20-19-13)18-12-3-1-2-4-14(12)21(22)23/h1-7H,8H2,(H,18,20) |
| InChIKey | FOIIAULLDAKVLN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 79.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|