C17H22N4S — CID 135673057
N-tert-butyl-5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135673057) has the molecular formula C17H22N4S and a molecular weight of 314.46 g/mol. Its IUPAC name is N-tert-butyl-5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-tert-butyl-5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135673057 |
| Molecular Formula | C17H22N4S |
| Molecular Weight | 314.46 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-tert-butyl-5-(7-ethyl-1H-indol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCc1cccc2c(C3=NN/C(=N/C(C)(C)C)SC3)c[nH]c12 |
| InChI | InChI=1S/C17H22N4S/c1-5-11-7-6-8-12-13(9-18-15(11)12)14-10-22-16(21-20-14)19-17(2,3)4/h6-9,18H,5,10H2,1-4H3,(H,19,21) |
| InChIKey | IXSZLGVTDCZCEO-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|