C16H27N5OS2 — CID 135673996
2-[2-(diethylamino)ethylamino]-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 135673996) has the molecular formula C16H27N5OS2 and a molecular weight of 369.56 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethylamino]-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 2-[2-(diethylamino)ethylamino]-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135673996 |
| Molecular Formula | C16H27N5OS2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[2-(diethylamino)ethylamino]-5-pentylsulfanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCCCCSc1nc2nc(NCCN(CC)CC)sc2c(=O)[nH]1 |
| InChI | InChI=1S/C16H27N5OS2/c1-4-7-8-11-23-16-19-13-12(14(22)20-16)24-15(18-13)17-9-10-21(5-2)6-3/h4-11H2,1-3H3,(H2,17,18,19,20,22) |
| InChIKey | ZETKLWNMQWASOP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|