C18H15F3N6O2 — CID 135674323
7-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 135674323) has the molecular formula C18H15F3N6O2 and a molecular weight of 404.35 g/mol. Its IUPAC name is 7-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135674323 |
| Molecular Formula | C18H15F3N6O2 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 7-[5-cyclopropyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-2-carbonyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=C(c1cc2nc(C3CC3)cc(C(F)(F)F)n2n1)N1CCc2c(nc[nH]c2=O)C1 |
| InChI | InChI=1S/C18H15F3N6O2/c19-18(20,21)14-5-11(9-1-2-9)24-15-6-12(25-27(14)15)17(29)26-4-3-10-13(7-26)22-8-23-16(10)28/h5-6,8-9H,1-4,7H2,(H,22,23,28) |
| InChIKey | BJKDRXHITAKFOP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |