About N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide
N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide (PubChem CID 135674466) has the molecular formula C19H31N5O2
and a molecular weight of 361.49 g/mol. Its IUPAC name is N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide |
| PubChem CID | 135674466 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide |
| SMILES | Cc1nc(NC2CCN(CC(=O)NC3CCCCC3)CC2)[nH]c(=O)c1C |
| InChI | InChI=1S/C19H31N5O2/c1-13-14(2)20-19(23-18(13)26)22-16-8-10-24(11-9-16)12-17(25)21-15-6-4-3-5-7-15/h15-16H,3-12H2,1-2H3,(H,21,25)(H2,20,22,23,26) |
| InChIKey | VJGYZBBBFMMQAQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide?
The IUPAC name of N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide (CID 135674466) is N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide.
What is the SMILES notation for N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide?
The canonical SMILES for N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide is Cc1nc(NC2CCN(CC(=O)NC3CCCCC3)CC2)[nH]c(=O)c1C.
What is the InChIKey of N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide?
The InChIKey is VJGYZBBBFMMQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31N5O2/c1-13-14(2)20-19(23-18(13)26)22-16-8-10-24(11-9-16)12-17(25)21-15-6-4-3-5-7-15/h15-16H,3-12H2,1-2H3,(H,21,25)(H2,20,22,23,26).
What are the key properties of N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide?
N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide has a molecular weight of 361.49 g/mol, XLogP of 1.71, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-[4-[(4,5-dimethyl-6-oxo-1H-pyrimidin-2-yl)amino]piperidin-1-yl]acetamide is sourced from PubChem (CID 135674466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).