C7H7FN3O3- — CID 135674883
(2R)-2-[(4-fluoro-6-oxo-1H-pyrimidin-2-yl)amino]propanoate (PubChem CID 135674883) has the molecular formula C7H7FN3O3- and a molecular weight of 200.15 g/mol. Its IUPAC name is (2R)-2-[(4-fluoro-6-oxo-1H-pyrimidin-2-yl)amino]propanoate.
| Compound Name | (2R)-2-[(4-fluoro-6-oxo-1H-pyrimidin-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 135674883 |
| Molecular Formula | C7H7FN3O3- |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | (2R)-2-[(4-fluoro-6-oxo-1H-pyrimidin-2-yl)amino]propanoate |
| SMILES | C[C@@H](Nc1nc(F)cc(=O)[nH]1)C(=O)[O-] |
| InChI | InChI=1S/C7H8FN3O3/c1-3(6(13)14)9-7-10-4(8)2-5(12)11-7/h2-3H,1H3,(H,13,14)(H2,9,10,11,12)/p-1/t3-/m1/s1 |
| InChIKey | HZMXVWXPJVWMFO-GSVOUGTGSA-M |
| XLogP | -1.54 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |