C23H19N3O2 — CID 135675392
3-(2-hydroxy-3-methylphenyl)-N-(4-phenylphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 135675392) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(2-hydroxy-3-methylphenyl)-N-(4-phenylphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(2-hydroxy-3-methylphenyl)-N-(4-phenylphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 135675392 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-(2-hydroxy-3-methylphenyl)-N-(4-phenylphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)Nc3ccc(-c4ccccc4)cc3)[nH]n2)c1O |
| InChI | InChI=1S/C23H19N3O2/c1-15-6-5-9-19(22(15)27)20-14-21(26-25-20)23(28)24-18-12-10-17(11-13-18)16-7-3-2-4-8-16/h2-14,27H,1H3,(H,24,28)(H,25,26) |
| InChIKey | ATYOXALHEHYDHJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |