About 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol
2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol (PubChem CID 135676074) has the molecular formula C18H17N3O2
and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol |
| PubChem CID | 135676074 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol |
| SMILES | Cc1c(O)ccc(/C(Cc2ccc3ccccc3n2)=N\N)c1O |
| InChI | InChI=1S/C18H17N3O2/c1-11-17(22)9-8-14(18(11)23)16(21-19)10-13-7-6-12-4-2-3-5-15(12)20-13/h2-9,22-23H,10,19H2,1H3/b21-16- |
| InChIKey | OEYGQMYNEWGXKZ-PGMHBOJBSA-N |
| XLogP | 2.86 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol?
The IUPAC name of 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol (CID 135676074) is 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol.
What is the SMILES notation for 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol?
The canonical SMILES for 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol is Cc1c(O)ccc(/C(Cc2ccc3ccccc3n2)=N\N)c1O.
What is the InChIKey of 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol?
The InChIKey is OEYGQMYNEWGXKZ-PGMHBOJBSA-N. The full InChI is InChI=1S/C18H17N3O2/c1-11-17(22)9-8-14(18(11)23)16(21-19)10-13-7-6-12-4-2-3-5-15(12)20-13/h2-9,22-23H,10,19H2,1H3/b21-16-.
What are the key properties of 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol?
2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol has a molecular weight of 307.35 g/mol, XLogP of 2.86, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(2-quinolin-2-ylethanehydrazonoyl)benzene-1,3-diol is sourced from PubChem (CID 135676074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).