C12H12N4O4 — CID 135676163
4-methyl-2-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one (PubChem CID 135676163) has the molecular formula C12H12N4O4 and a molecular weight of 276.25 g/mol. Its IUPAC name is 4-methyl-2-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135676163 |
| Molecular Formula | C12H12N4O4 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-methyl-2-[(2E)-2-[(2,3,4-trihydroxyphenyl)methylidene]hydrazinyl]-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(N/N=C/c2ccc(O)c(O)c2O)n1 |
| InChI | InChI=1S/C12H12N4O4/c1-6-4-9(18)15-12(14-6)16-13-5-7-2-3-8(17)11(20)10(7)19/h2-5,17,19-20H,1H3,(H2,14,15,16,18)/b13-5+ |
| InChIKey | IXRGWWQNQYAZHN-WLRTZDKTSA-N |
| XLogP | 0.64 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|