C8H9F2N4O2- — CID 135677746
(5S,7R)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 135677746) has the molecular formula C8H9F2N4O2- and a molecular weight of 231.18 g/mol. Its IUPAC name is (5S,7R)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | (5S,7R)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 135677746 |
| Molecular Formula | C8H9F2N4O2- |
| Molecular Weight | 231.18 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (5S,7R)-7-(difluoromethyl)-5-methyl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | C[C@H]1C[C@H](C(F)F)n2nc(C(=O)[O-])nc2N1 |
| InChI | InChI=1S/C8H10F2N4O2/c1-3-2-4(5(9)10)14-8(11-3)12-6(13-14)7(15)16/h3-5H,2H2,1H3,(H,15,16)(H,11,12,13)/p-1/t3-,4+/m0/s1 |
| InChIKey | XYHOJJYLZCLYCM-IUYQGCFVSA-M |
| XLogP | -0.35 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.18 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |