About benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate
benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate (PubChem CID 135678036) has the molecular formula C21H15Cl2NO3
and a molecular weight of 400.26 g/mol. Its IUPAC name is benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate.
Molecular Properties
| Compound Name | benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate |
| PubChem CID | 135678036 |
| Molecular Formula | C21H15Cl2NO3 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate |
| SMILES | O=C(OCc1ccccc1)/C(=C(\O)c1c(Cl)cccc1Cl)c1ccccn1 |
| InChI | InChI=1S/C21H15Cl2NO3/c22-15-9-6-10-16(23)18(15)20(25)19(17-11-4-5-12-24-17)21(26)27-13-14-7-2-1-3-8-14/h1-12,25H,13H2/b20-19- |
| InChIKey | YSUKMNAPVATVOJ-VXPUYCOJSA-N |
| XLogP | 5.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate?
The IUPAC name of benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate (CID 135678036) is benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate.
What is the SMILES notation for benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate?
The canonical SMILES for benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate is O=C(OCc1ccccc1)/C(=C(\O)c1c(Cl)cccc1Cl)c1ccccn1.
What is the InChIKey of benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate?
The InChIKey is YSUKMNAPVATVOJ-VXPUYCOJSA-N. The full InChI is InChI=1S/C21H15Cl2NO3/c22-15-9-6-10-16(23)18(15)20(25)19(17-11-4-5-12-24-17)21(26)27-13-14-7-2-1-3-8-14/h1-12,25H,13H2/b20-19-.
What are the key properties of benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate?
benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate has a molecular weight of 400.26 g/mol, XLogP of 5.56, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (Z)-3-(2,6-dichlorophenyl)-3-hydroxy-2-pyridin-2-ylprop-2-enoate is sourced from PubChem (CID 135678036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).