About 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol
2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol (PubChem CID 135678114) has the molecular formula C18H13N3O3
and a molecular weight of 319.32 g/mol. Its IUPAC name is 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol.
Molecular Properties
| Compound Name | 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol |
| PubChem CID | 135678114 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol |
| SMILES | Oc1ccc(-c2nn3cc(O)cnc3c2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H13N3O3/c22-13-5-1-11(2-6-13)16-17(12-3-7-14(23)8-4-12)20-21-10-15(24)9-19-18(16)21/h1-10,22-24H |
| InChIKey | XZDBAWYEMYSRFY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol?
The IUPAC name of 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol (CID 135678114) is 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol.
What is the SMILES notation for 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol?
The canonical SMILES for 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol is Oc1ccc(-c2nn3cc(O)cnc3c2-c2ccc(O)cc2)cc1.
What is the InChIKey of 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol?
The InChIKey is XZDBAWYEMYSRFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N3O3/c22-13-5-1-11(2-6-13)16-17(12-3-7-14(23)8-4-12)20-21-10-15(24)9-19-18(16)21/h1-10,22-24H.
What are the key properties of 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol?
2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol has a molecular weight of 319.32 g/mol, XLogP of 3.18, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(4-hydroxyphenyl)pyrazolo[1,5-a]pyrimidin-6-ol is sourced from PubChem (CID 135678114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).