About (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene
(E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene (PubChem CID 135679332) has the molecular formula C7H6N4S
and a molecular weight of 178.22 g/mol. Its IUPAC name is (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene.
Molecular Properties
| Compound Name | (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene |
| PubChem CID | 135679332 |
| Molecular Formula | C7H6N4S |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene |
| SMILES | c1c[nH]c(/N=N/c2nccs2)c1 |
| InChI | InChI=1S/C7H6N4S/c1-2-6(8-3-1)10-11-7-9-4-5-12-7/h1-5,8H/b11-10+ |
| InChIKey | FLCRRDDPPNONFG-ZHACJKMWSA-N |
| XLogP | 2.89 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene?
The IUPAC name of (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene (CID 135679332) is (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene.
What is the SMILES notation for (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene?
The canonical SMILES for (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene is c1c[nH]c(/N=N/c2nccs2)c1.
What is the InChIKey of (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene?
The InChIKey is FLCRRDDPPNONFG-ZHACJKMWSA-N. The full InChI is InChI=1S/C7H6N4S/c1-2-6(8-3-1)10-11-7-9-4-5-12-7/h1-5,8H/b11-10+.
What are the key properties of (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene?
(E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene has a molecular weight of 178.22 g/mol, XLogP of 2.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1H-pyrrol-2-yl(1,3-thiazol-2-yl)diazene is sourced from PubChem (CID 135679332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).