C14H13N5O2S — CID 135680606
3-[2-(3,4-dimethylphenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one (PubChem CID 135680606) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is 3-[2-(3,4-dimethylphenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one.
| Compound Name | 3-[2-(3,4-dimethylphenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
|---|---|
| PubChem CID | 135680606 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 3-[2-(3,4-dimethylphenyl)-2-oxoethyl]sulfanyl-8H-[1,2,4]triazolo[4,3-b][1,2,4]triazin-7-one |
| SMILES | Cc1ccc(C(=O)CSc2nnc3[nH]c(=O)cnn23)cc1C |
| InChI | InChI=1S/C14H13N5O2S/c1-8-3-4-10(5-9(8)2)11(20)7-22-14-18-17-13-16-12(21)6-15-19(13)14/h3-6H,7H2,1-2H3,(H,16,17,21) |
| InChIKey | JRYVWNBUCVINHO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |