C14H17F2N3OS — CID 135680766
N-tert-butyl-5-[4-(difluoromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135680766) has the molecular formula C14H17F2N3OS and a molecular weight of 313.37 g/mol. Its IUPAC name is N-tert-butyl-5-[4-(difluoromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-tert-butyl-5-[4-(difluoromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135680766 |
| Molecular Formula | C14H17F2N3OS |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N-tert-butyl-5-[4-(difluoromethoxy)phenyl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CC(C)(C)/N=C1/NN=C(c2ccc(OC(F)F)cc2)CS1 |
| InChI | InChI=1S/C14H17F2N3OS/c1-14(2,3)17-13-19-18-11(8-21-13)9-4-6-10(7-5-9)20-12(15)16/h4-7,12H,8H2,1-3H3,(H,17,19) |
| InChIKey | MHSKUWSQSVKTSX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|