C22H16Br2N2O3 — CID 135681376
2,4-dibromo-5-methyl-6-[[3-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol (PubChem CID 135681376) has the molecular formula C22H16Br2N2O3 and a molecular weight of 516.19 g/mol. Its IUPAC name is 2,4-dibromo-5-methyl-6-[[3-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol.
| Compound Name | 2,4-dibromo-5-methyl-6-[[3-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135681376 |
| Molecular Formula | C22H16Br2N2O3 |
| Molecular Weight | 516.19 g/mol |
| Exact Mass | 513.95 |
| IUPAC Name | 2,4-dibromo-5-methyl-6-[[3-(4-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]benzene-1,3-diol |
| SMILES | Cc1c(Br)c(O)c(Br)c(O)c1/C=N/c1cccc(-c2nc3c(C)cccc3o2)c1 |
| InChI | InChI=1S/C22H16Br2N2O3/c1-11-5-3-8-16-19(11)26-22(29-16)13-6-4-7-14(9-13)25-10-15-12(2)17(23)21(28)18(24)20(15)27/h3-10,27-28H,1-2H3/b25-10+ |
| InChIKey | RCLMPFOVQSIOSO-KIBLKLHPSA-N |
| XLogP | 6.80 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.19 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|