C24H25ClN6O3 — CID 135681852
2-[4-[[2-(3-chloro-4-methoxyphenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide (PubChem CID 135681852) has the molecular formula C24H25ClN6O3 and a molecular weight of 480.96 g/mol. Its IUPAC name is 2-[4-[[2-(3-chloro-4-methoxyphenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[4-[[2-(3-chloro-4-methoxyphenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 135681852 |
| Molecular Formula | C24H25ClN6O3 |
| Molecular Weight | 480.96 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 2-[4-[[2-(3-chloro-4-methoxyphenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide |
| SMILES | C/N=C(\N)c1cc(C)c2nc(-c3c(NCC(O)c4ccc(OC)c(Cl)c4)cc[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C24H25ClN6O3/c1-12-8-14(22(26)27-2)10-17-21(12)31-23(30-17)20-16(6-7-28-24(20)33)29-11-18(32)13-4-5-19(34-3)15(25)9-13/h4-10,18,32H,11H2,1-3H3,(H2,26,27)(H,30,31)(H2,28,29,33) |
| InChIKey | RHTQMMRIBLMVQL-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 141.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.96 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|