C29H32ClFN6O4 — CID 135681901
1-[2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazol-5-yl]-N-(2-fluoroethoxy)piperidine-4-carboxamide (PubChem CID 135681901) has the molecular formula C29H32ClFN6O4 and a molecular weight of 583.06 g/mol. Its IUPAC name is 1-[2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazol-5-yl]-N-(2-fluoroethoxy)piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazol-5-yl]-N-(2-fluoroethoxy)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 135681901 |
| Molecular Formula | C29H32ClFN6O4 |
| Molecular Weight | 583.06 g/mol |
| Exact Mass | 582.22 |
| IUPAC Name | 1-[2-[4-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]-2-oxo-1H-pyridin-3-yl]-7-methyl-3H-benzimidazol-5-yl]-N-(2-fluoroethoxy)piperidine-4-carboxamide |
| SMILES | Cc1cc(N2CCC(C(=O)NOCCF)CC2)cc2[nH]c(-c3c(NCC(O)c4cccc(Cl)c4)cc[nH]c3=O)nc12 |
| InChI | InChI=1S/C29H32ClFN6O4/c1-17-13-21(37-10-6-18(7-11-37)28(39)36-41-12-8-31)15-23-26(17)35-27(34-23)25-22(5-9-32-29(25)40)33-16-24(38)19-3-2-4-20(30)14-19/h2-5,9,13-15,18,24,38H,6-8,10-12,16H2,1H3,(H,34,35)(H,36,39)(H2,32,33,40) |
| InChIKey | LWELCYJSAYQTOX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.06 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|