About 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one
6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 135682068) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| PubChem CID | 135682068 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CCc1nc2[nH]ncc2c(=O)[nH]1 |
| InChI | InChI=1S/C7H8N4O/c1-2-5-9-6-4(3-8-11-6)7(12)10-5/h3H,2H2,1H3,(H2,8,9,10,11,12) |
| InChIKey | GECPKVWDUUIBPL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The IUPAC name of 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one (CID 135682068) is 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one.
What is the SMILES notation for 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The canonical SMILES for 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is CCc1nc2[nH]ncc2c(=O)[nH]1.
What is the InChIKey of 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
The InChIKey is GECPKVWDUUIBPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-2-5-9-6-4(3-8-11-6)7(12)10-5/h3H,2H2,1H3,(H2,8,9,10,11,12).
What are the key properties of 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one?
6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one has a molecular weight of 164.17 g/mol, XLogP of 0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1,5-dihydropyrazolo[5,4-d]pyrimidin-4-one is sourced from PubChem (CID 135682068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).