C15H15Br2N3O — CID 135682606
(1S)-2,2-dibromo-1-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]cyclopropane-1-carboxamide (PubChem CID 135682606) has the molecular formula C15H15Br2N3O and a molecular weight of 413.11 g/mol. Its IUPAC name is (1S)-2,2-dibromo-1-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-dibromo-1-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 135682606 |
| Molecular Formula | C15H15Br2N3O |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.96 |
| IUPAC Name | (1S)-2,2-dibromo-1-methyl-N-[(E)-(2-methyl-1H-indol-3-yl)methylideneamino]cyclopropane-1-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1/C=N/NC(=O)[C@]1(C)CC1(Br)Br |
| InChI | InChI=1S/C15H15Br2N3O/c1-9-11(10-5-3-4-6-12(10)19-9)7-18-20-13(21)14(2)8-15(14,16)17/h3-7,19H,8H2,1-2H3,(H,20,21)/b18-7+/t14-/m0/s1 |
| InChIKey | WOXRULFJDNMOBW-AVWXOPBPSA-N |
| XLogP | 3.82 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|