C19H18ClN5O3 — CID 135682814
(3aR,7aS)-2-[(7R)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 135682814) has the molecular formula C19H18ClN5O3 and a molecular weight of 399.84 g/mol. Its IUPAC name is (3aR,7aS)-2-[(7R)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[(7R)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 135682814 |
| Molecular Formula | C19H18ClN5O3 |
| Molecular Weight | 399.84 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (3aR,7aS)-2-[(7R)-7-(4-chlorophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1C[C@H](c2ccc(Cl)cc2)n2nc(N3C(=O)[C@H]4CCCC[C@H]4C3=O)nc2N1 |
| InChI | InChI=1S/C19H18ClN5O3/c20-11-7-5-10(6-8-11)14-9-15(26)21-18-22-19(23-25(14)18)24-16(27)12-3-1-2-4-13(12)17(24)28/h5-8,12-14H,1-4,9H2,(H,21,22,23,26)/t12-,13+,14-/m1/s1 |
| InChIKey | OTBFORVHEIXCFR-HZSPNIEDSA-N |
| XLogP | 2.54 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.84 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|