C24H24N2O5 — CID 135684346
2-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-2,2-bis(4-methoxyphenyl)acetamide (PubChem CID 135684346) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-2,2-bis(4-methoxyphenyl)acetamide.
| Compound Name | 2-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-2,2-bis(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135684346 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-hydroxy-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]-2,2-bis(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(C(O)(C(=O)N/N=C(\C)c2ccccc2O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O5/c1-16(21-6-4-5-7-22(21)27)25-26-23(28)24(29,17-8-12-19(30-2)13-9-17)18-10-14-20(31-3)15-11-18/h4-15,27,29H,1-3H3,(H,26,28)/b25-16+ |
| InChIKey | KGRTVBJKXSVXKO-PCLIKHOPSA-N |
| XLogP | 3.19 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|